|
CAS#: 792-38-1 Product: N'-[1-(2-Hydroxy-4-oxo-2,5-cyclohexadien-1-ylidene)ethyl]isonicotinohydrazide No suppilers available for the product. |
| Name | N'-[1-(2-Hydroxy-4-oxo-2,5-cyclohexadien-1-ylidene)ethyl]isonicotinohydrazide |
|---|---|
| Synonyms | NSC54042; ZINC00493220 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.27 |
| CAS Registry Number | 792-38-1 |
| SMILES | O=C(NNC(=C1/C=C\C(=O)\C=C1\O)C)c2ccncc2 |
| InChI | 1S/C14H13N3O3/c1-9(12-3-2-11(18)8-13(12)19)16-17-14(20)10-4-6-15-7-5-10/h2-8,16,19H,1H3,(H,17,20) |
| InChIKey | YEISIWVJAUPVEZ-UHFFFAOYSA-N |
| Density | 1.379g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.271°C at 760 mmHg (Cal.) |
| Flash point | 195.272°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N'-[1-(2-Hydroxy-4-oxo-2,5-cyclohexadien-1-ylidene)ethyl]isonicotinohydrazide |