|
CAS#: 79232-29-4 Product: Alliacol A No suppilers available for the product. |
| Name | Alliacol A |
|---|---|
| Synonyms | Alliacol A |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 79232-29-4 |
| SMILES | CC3(C4C2(C1(C(C(=C)C(O1)=O)(O)CCC2C)C3)O4)C |
| InChI | 1S/C15H20O4/c1-8-5-6-13(17)9(2)10(16)18-14(13)7-12(3,4)11-15(8,14)19-11/h8,11,17H,2,5-7H2,1,3-4H3 |
| InChIKey | VLJBPLOIFLPLAP-UHFFFAOYSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.882°C at 760 mmHg (Cal.) |
| Flash point | 171.442°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Alliacol A |