|
CAS#: 79301-80-7 Product: 4-[Anilino(phenyl)methylene]-3-hydroxy-2,5-cyclohexadien-1-one No suppilers available for the product. |
| Name | 4-[Anilino(phenyl)methylene]-3-hydroxy-2,5-cyclohexadien-1-one |
|---|---|
| Synonyms | NSC52934 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 |
| CAS Registry Number | 79301-80-7 |
| SMILES | O=C/3/C=C\C(=C(c1ccccc1)Nc2ccccc2)C(\O)=C\3 |
| InChI | 1S/C19H15NO2/c21-16-11-12-17(18(22)13-16)19(14-7-3-1-4-8-14)20-15-9-5-2-6-10-15/h1-13,20,22H |
| InChIKey | NKSFZWBSMQCXDB-UHFFFAOYSA-N |
| Density | 1.318g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.444°C at 760 mmHg (Cal.) |
| Flash point | 229.85°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[Anilino(phenyl)methylene]-3-hydroxy-2,5-cyclohexadien-1-one |