|
CAS#: 79305-82-1 Product: 3-[2-(4-Aminophenyl)Ethenyl]Aniline No suppilers available for the product. |
| Name | 3-[2-(4-Aminophenyl)Ethenyl]Aniline |
|---|---|
| Synonyms | 3-[(E)-2-(4-Aminophenyl)Ethenyl]Aniline; 3-[2-(4-Aminophenyl)Vinyl]Aniline; 3-[(E)-2-(4-Aminophenyl)Vinyl]Aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 |
| CAS Registry Number | 79305-82-1 |
| SMILES | C1=CC(=CC=C1N)\C=C\C2=CC(=CC=C2)N |
| InChI | 1S/C14H14N2/c15-13-8-6-11(7-9-13)4-5-12-2-1-3-14(16)10-12/h1-10H,15-16H2/b5-4+ |
| InChIKey | IXGDBTKLQUHIAX-SNAWJCMRSA-N |
| Density | 1.187g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.749°C at 760 mmHg (Cal.) |
| Flash point | 263.445°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[2-(4-Aminophenyl)Ethenyl]Aniline |