|
CAS#: 79381-26-3 Product: 2,9-Dibromobenzanthrone No suppilers available for the product. |
| Name | 2,9-Dibromobenzanthrone |
|---|---|
| Synonyms | 7H-Benz(De)Anthracen-7-One, 2,9-Dibromo- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H8Br2O |
| Molecular Weight | 388.06 |
| CAS Registry Number | 79381-26-3 |
| SMILES | C1=CC=C3C2=C1C(C4=C(C2=CC(=C3)Br)C=CC(=C4)Br)=O |
| InChI | 1S/C17H8Br2O/c18-10-4-5-12-14-8-11(19)6-9-2-1-3-13(16(9)14)17(20)15(12)7-10/h1-8H |
| InChIKey | UEGNJEQZORJLBN-UHFFFAOYSA-N |
| Density | 1.836g/cm3 (Cal.) |
|---|---|
| Boiling point | 535.537°C at 760 mmHg (Cal.) |
| Flash point | 178.206°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,9-Dibromobenzanthrone |