|
CAS#: 794461-86-2 Product: Ethyl 2-(trifluoromethyl)-5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylate No suppilers available for the product. |
| Name | Ethyl 2-(trifluoromethyl)-5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylate |
|---|---|
| Synonyms | 1,7-Napht |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 |
| CAS Registry Number | 794461-86-2 |
| SMILES | CCOC(=O)c1cc2c(nc1C(F)(F)F)CNCC2 |
| InChI | 1S/C12H13F3N2O2/c1-2-19-11(18)8-5-7-3-4-16-6-9(7)17-10(8)12(13,14)15/h5,16H,2-4,6H2,1H3 |
| InChIKey | HQUITAKYLCSYBG-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.3±42.0°C at 760 mmHg (Cal.) |
| Flash point | 160.2±27.9°C (Cal.) |
| Refractive index | 1.486 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-(trifluoromethyl)-5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylate |