|
CAS#: 794479-16-6 Product: 8-Phenyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro[1,2,4]triazolo[4,3-a]pyrazine No suppilers available for the product. |
| Name | 8-Phenyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| Synonyms | 8-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11F3N4 |
| Molecular Weight | 268.24 |
| CAS Registry Number | 794479-16-6 |
| SMILES | C1CN2C(=NN=C2C(F)(F)F)C(N1)C3=CC=CC=C3 |
| InChI | 1S/C12H11F3N4/c13-12(14,15)11-18-17-10-9(16-6-7-19(10)11)8-4-2-1-3-5-8/h1-5,9,16H,6-7H2 |
| InChIKey | YXHPKGBOXWOOAM-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.8±52.0°C at 760 mmHg (Cal.) |
| Flash point | 183.5±30.7°C (Cal.) |
| Refractive index | 1.626 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Phenyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro[1,2,4]triazolo[4,3-a]pyrazine |