|
CAS#: 79449-96-0 Product: Altanserin tartrate No suppilers available for the product. |
| Name | Altanserin tartrate |
|---|---|
| Synonyms | (2R,3R)-2,3-Dihydroxybutanedioic Acid; 3-[2-[4-(4-Fluorobenzoyl)-1-Piperidyl]Ethyl]-2-Thioxo-1H-Quinazolin-4-One; (2R,3R)-2,3-Dihydroxybutanedioic Acid; 3-[2-[4-[(4-Fluorophenyl)-Oxomethyl]-1-Piperidinyl]Ethyl]-2-Thioxo-1H-Quinazolin-4-One; 3-[2-[4-(4-Fluorobenzoyl)-1-Piperidyl]Ethyl]-2-Thioxo-1H-Quinazolin-4-One; Tartaric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C26H28FN3O8S |
| Molecular Weight | 561.58 |
| CAS Registry Number | 79449-96-0 |
| EINECS | 279-159-5 |
| SMILES | [C@@H](O)([C@@H](O)C(=O)O)C(=O)O.C1=CC=CC2=C1C(=O)N(C(=S)N2)CCN4CCC(C(=O)C3=CC=C(F)C=C3)CC4 |
| InChI | 1S/C22H22FN3O2S.C4H6O6/c23-17-7-5-15(6-8-17)20(27)16-9-11-25(12-10-16)13-14-26-21(28)18-3-1-2-4-19(18)24-22(26)29;5-1(3(7)8)2(6)4(9)10/h1-8,16H,9-14H2,(H,24,29);1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | VZGOQPXIRAHJLV-LREBCSMRSA-N |
| Boiling point | 580.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 304.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Altanserin tartrate |