|
CAS#: 79492-73-2 Product: 6,7-Dihydroxy-2-(3,4,5-Trimethoxyphenyl)Chromen-4-One No suppilers available for the product. |
| Name | 6,7-Dihydroxy-2-(3,4,5-Trimethoxyphenyl)Chromen-4-One |
|---|---|
| Synonyms | 6,7-Dihydroxy-2-(3,4,5-Trimethoxyphenyl)-4-Chromenone; 6,7-Dihydroxy-2-(3,4,5-Trimethoxyphenyl)Chromone; 4H-1-Benzopyran-4-One, 6,7-Dihydroxy-2-(3,4,5-Trimethoxyphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 |
| CAS Registry Number | 79492-73-2 |
| SMILES | C3=C(C2=CC(=O)C1=CC(=C(O)C=C1O2)O)C=C(OC)C(=C3OC)OC |
| InChI | 1S/C18H16O7/c1-22-16-4-9(5-17(23-2)18(16)24-3)14-7-11(19)10-6-12(20)13(21)8-15(10)25-14/h4-8,20-21H,1-3H3 |
| InChIKey | COJGTOWPKOSQSC-UHFFFAOYSA-N |
| Density | 1.388g/cm3 (Cal.) |
|---|---|
| Boiling point | 586.238°C at 760 mmHg (Cal.) |
| Flash point | 215.731°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Dihydroxy-2-(3,4,5-Trimethoxyphenyl)Chromen-4-One |