|
CAS#: 795-38-0 Product: (-)-Dihydroisocodeine No suppilers available for the product. |
| Name | (-)-Dihydroisocodeine |
|---|---|
| Synonyms | Dhic; Dihydroisocodeine; Isocodeine, Dihydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.38 |
| CAS Registry Number | 795-38-0 |
| SMILES | [C@@]125C3=C4C[C@H]([C@@H]1CC[C@H](C2OC3=C(C=C4)OC)O)N(CC5)C |
| InChI | 1S/C18H23NO3/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19/h3,6,11-13,17,20H,4-5,7-9H2,1-2H3/t11-,12+,13+,17?,18-/m0/s1 |
| InChIKey | RBOXVHNMENFORY-LJCHMUPYSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.996°C at 760 mmHg (Cal.) |
| Flash point | 233.207°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (-)-Dihydroisocodeine |