|
CAS#: 795274-98-5 Product: Ethyl (2E)-2-(2,5-dimethylphenyl)-3-hydroxyacrylate No suppilers available for the product. |
| Name | Ethyl (2E)-2-(2,5-dimethylphenyl)-3-hydroxyacrylate |
|---|---|
| Synonyms | (E)-ethyl 2-(2,5-dimethylphenyl)-3-hydroxyacrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26 |
| CAS Registry Number | 795274-98-5 |
| SMILES | CCOC(=O)/C(=C/O)/c1cc(ccc1C)C |
| InChI | 1S/C13H16O3/c1-4-16-13(15)12(8-14)11-7-9(2)5-6-10(11)3/h5-8,14H,4H2,1-3H3/b12-8+ |
| InChIKey | LHOHXILBQOWSST-XYOKQWHBSA-N |
| Density | 1.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.065°C at 760 mmHg (Cal.) |
| Flash point | 145.557°C (Cal.) |
| Refractive index | 1.542 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2E)-2-(2,5-dimethylphenyl)-3-hydroxyacrylate |