|
CAS#: 79682-25-0 Product: 1,2,3,4,5-Pentabromo-6-(3,4-Dibromophenyl)Benzene No suppilers available for the product. |
| Name | 1,2,3,4,5-Pentabromo-6-(3,4-Dibromophenyl)Benzene |
|---|---|
| Synonyms | 1,1'-Biphenyl, 2,3,3',4,4',5,6-Heptabromo-; 2,3,3',4,4'5,6-Heptabromobiphenyl; Heptbbp |
| Molecular Structure | ![]() |
| Molecular Formula | C12H3Br7 |
| Molecular Weight | 706.48 |
| CAS Registry Number | 79682-25-0 |
| SMILES | C1=C(C(=CC=C1C2=C(C(=C(C(=C2Br)Br)Br)Br)Br)Br)Br |
| InChI | 1S/C12H3Br7/c13-5-2-1-4(3-6(5)14)7-8(15)10(17)12(19)11(18)9(7)16/h1-3H |
| InChIKey | RKSHLITXOOZMAV-UHFFFAOYSA-N |
| Density | 2.636g/cm3 (Cal.) |
|---|---|
| Boiling point | 502.798°C at 760 mmHg (Cal.) |
| Flash point | 248.083°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5-Pentabromo-6-(3,4-Dibromophenyl)Benzene |