|
CAS#: 79714-32-2 Product: Ethyl chloro(3,4-dimethylphenyl)acetate No suppilers available for the product. |
| Name | Ethyl chloro(3,4-dimethylphenyl)acetate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 |
| CAS Registry Number | 79714-32-2 |
| SMILES | O=C(OCC)C(Cl)c1cc(c(cc1)C)C |
| InChI | 1S/C12H15ClO2/c1-4-15-12(14)11(13)10-6-5-8(2)9(3)7-10/h5-7,11H,4H2,1-3H3 |
| InChIKey | LXCMAVGXLLQHIN-UHFFFAOYSA-N |
| Density | 1.114g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.482°C at 760 mmHg (Cal.) |
| Flash point | 142.845°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl chloro(3,4-dimethylphenyl)acetate |