|
CAS#: 79763-01-2 Product: 2,3-Dichloro-4-Nitro-1H-Pyrrole No suppilers available for the product. |
| Name | 2,3-Dichloro-4-Nitro-1H-Pyrrole |
|---|---|
| Synonyms | 1H-Pyrrole, 2,3-Dichloro-4-Nitro; Aids-009340; Aids009340 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H2Cl2N2O2 |
| Molecular Weight | 180.98 |
| CAS Registry Number | 79763-01-2 |
| SMILES | C1=C(C(=C(Cl)[NH]1)Cl)[N+](=O)[O-] |
| InChI | 1S/C4H2Cl2N2O2/c5-3-2(8(9)10)1-7-4(3)6/h1,7H |
| InChIKey | CDHAYBUDIPNGGJ-UHFFFAOYSA-N |
| Density | 1.749g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.504°C at 760 mmHg (Cal.) |
| Flash point | 150.66°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dichloro-4-Nitro-1H-Pyrrole |