|
CAS#: 79821-07-1 Product: 2-(4-Chlorophenyl)-4,5-Dihydroxyfuran-3-One No suppilers available for the product. |
| Name | 2-(4-Chlorophenyl)-4,5-Dihydroxyfuran-3-One |
|---|---|
| Synonyms | 2-(4-Chlorophenyl)-4,5-Dihydroxy-Furan-3-One; 2-(4-Chlorophenyl)-4,5-Dihydroxy-3-Furanone; 5-(4-Chlorophenyl)-3,4-Dihydroxy-2(5H)-Furanone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7ClO4 |
| Molecular Weight | 226.62 |
| CAS Registry Number | 79821-07-1 |
| SMILES | C2=C(C1OC(=C(O)C1=O)O)C=CC(=C2)Cl |
| InChI | 1S/C10H7ClO4/c11-6-3-1-5(2-4-6)9-7(12)8(13)10(14)15-9/h1-4,9,13-14H |
| InChIKey | SADYYVYRJRKFTD-UHFFFAOYSA-N |
| Density | 1.671g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.129°C at 760 mmHg (Cal.) |
| Flash point | 176.438°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Chlorophenyl)-4,5-Dihydroxyfuran-3-One |