|
CAS#: 79912-85-9 Product: 4-Fluorophenyl 4-heptylcyclohexanecarboxylate No suppilers available for the product. |
| Name | 4-Fluorophenyl 4-heptylcyclohexanecarboxylate |
|---|---|
| Synonyms | 4-Fluorophenyl 4-heptylcyclohexanecarboxylate # |
| Molecular Structure | ![]() |
| Molecular Formula | C20H29FO2 |
| Molecular Weight | 320.44 |
| CAS Registry Number | 79912-85-9 |
| SMILES | Fc2ccc(OC(=O)C1CCC(CCCCCCC)CC1)cc2 |
| InChI | 1S/C20H29FO2/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)20(22)23-19-14-12-18(21)13-15-19/h12-17H,2-11H2,1H3 |
| InChIKey | LSDPYLPHCDWCEQ-UHFFFAOYSA-N |
| Density | 1.021g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.14°C at 760 mmHg (Cal.) |
| Flash point | 190.746°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Fluorophenyl 4-heptylcyclohexanecarboxylate |