CAS#: 79950-85-9 Product: Sohirnone B No suppilers available for the product. |
Name | Sohirnone B |
---|---|
Synonyms | (2E,4E)-1-(2,4-Dihydroxy-3,5-Dimethyl-Phenyl)Hexa-2,4-Dien-1-One; Megxm0_000242; Sorbicillin |
Molecular Structure | ![]() |
Molecular Formula | C14H16O3 |
Molecular Weight | 232.28 |
CAS Registry Number | 79950-85-9 |
SMILES | C1=C(C(=C(C(=C1C(/C=C/C=C/C)=O)O)C)O)C |
InChI | 1S/C14H16O3/c1-4-5-6-7-12(15)11-8-9(2)13(16)10(3)14(11)17/h4-8,16-17H,1-3H3/b5-4+,7-6+ |
InChIKey | RKKPUBAAIGFXOG-YTXTXJHMSA-N |
Density | 1.141g/cm3 (Cal.) |
---|---|
Boiling point | 425.737°C at 760 mmHg (Cal.) |
Flash point | 225.422°C (Cal.) |
Market Analysis Reports |
List of Reports Available for Sohirnone B |