|
CAS#: 79992-72-6 Product: Elsinore Pill No suppilers available for the product. |
| Name | Elsinore Pill |
|---|---|
| Synonyms | (1R,2S)-2-Methylamino-1-Phenyl-Propan-1-Ol; 1,3,7-Trimethylpurine-2,6-Dione; Caffeine; (1R,2S)-2-Methylamino-1-Phenyl-Propan-1-Ol; 1H-Purine-2,6-Dione, 3,7-Dihydro-1,3,7-Trimethyl-, Mixt. With (R-(R*,S*))-Alpha-(1-(Methylamino)Ethyl)Benzenemethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 |
| CAS Registry Number | 79992-72-6 |
| SMILES | [C@@H](O)(C1=CC=CC=C1)[C@@H](NC)C.C2=NC3=C([N]2C)C(=O)N(C(=O)N3C)C |
| InChI | 1S/C10H15NO.C8H10N4O2/c1-8(11-2)10(12)9-6-4-3-5-7-9;1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h3-8,10-12H,1-2H3;4H,1-3H3/t8-,10-;/m0./s1 |
| InChIKey | CTSFIJCLRRGCGJ-GNAZCLTHSA-N |
| Boiling point | 416.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 205.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Elsinore Pill |