|
CAS#: 80036-90-4 Product: Methyl 5-(ethylsulfonyl)-2-methoxy-4-nitrobenzoate No suppilers available for the product. |
| Name | Methyl 5-(ethylsulfonyl)-2-methoxy-4-nitrobenzoate |
|---|---|
| Synonyms | methyl 5-(ethylsulphonyl)-4-nitro-o-anisate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO7S |
| Molecular Weight | 303.29 |
| CAS Registry Number | 80036-90-4 |
| EINECS | 279-379-1 |
| SMILES | COc1cc(c(cc1C(=O)OC)S(=O)(=O)CC)[N+]([O-])=O |
| InChI | 1S/C11H13NO7S/c1-4-20(16,17)10-5-7(11(13)19-3)9(18-2)6-8(10)12(14)15/h5-6H,4H2,1-3H3 |
| InChIKey | RCOBUYURWGWJBZ-UHFFFAOYSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 522.417°C at 760 mmHg (Cal.) |
| Flash point | 269.748°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 5-(ethylsulfonyl)-2-methoxy-4-nitrobenzoate |