Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Sinova Corporation | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (301) 961-1525 | |||
|
sales@sinovainc.com | |||
| Chemical manufacturer | ||||
| Name | Ethyl 5-methyl-1H-pyrrolo[2,3-c]pyridine-2-carboxylate |
|---|---|
| Synonyms | 5-Methyl-6-azaindole-2-carboxylic acid ethyl ester |
| Molecular Structure | ![CAS#: 800401-90-5, Ethyl 5-methyl-1H-pyrrolo[2,3-c]pyridine-2-carboxylate](/moreStructures/800401-90-5.gif) |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 |
| CAS Registry Number | 800401-90-5 |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=NC(=C2)C |
| InChI | 1S/C11H12N2O2/c1-3-15-11(14)9-5-8-4-7(2)12-6-10(8)13-9/h4-6,13H,3H2,1-2H3 |
| InChIKey | ANFSMOBHBMAIKL-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 148-150°C (Expl.) |
| Boiling point | 371.1±37.0°C at 760 mmHg (Cal.) |
| Flash point | 178.3±26.5°C (Cal.) |
| Refractive index | 1.615 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 5-methyl-1H-pyrrolo[2,3-c]pyridine-2-carboxylate |