|
CAS#: 80049-88-3 Product: (2-Ethylhexenyl)Succinic Anhydride No suppilers available for the product. |
| Name | (2-Ethylhexenyl)Succinic Anhydride |
|---|---|
| Synonyms | 3-[(E)-2-Ethylhex-2-Enyl]Tetrahydrofuran-2,5-Dione; 3-[(E)-2-Ethylhex-2-Enyl]Tetrahydrofuran-2,5-Quinone; (2-Eh)Sa |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 |
| CAS Registry Number | 80049-88-3 |
| SMILES | C(C1C(OC(=O)C1)=O)\C(=C\CCC)CC |
| InChI | 1S/C12H18O3/c1-3-5-6-9(4-2)7-10-8-11(13)15-12(10)14/h6,10H,3-5,7-8H2,1-2H3/b9-6+ |
| InChIKey | GAWFSSQLRLBHKK-RMKNXTFCSA-N |
| Density | 1.037g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.303°C at 760 mmHg (Cal.) |
| Flash point | 147.803°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Ethylhexenyl)Succinic Anhydride |