|
CAS#: 80095-30-3 Product: 4-(2-(3-Indoyl)Ethyl)-2-Piperidinone No suppilers available for the product. |
| Name | 4-(2-(3-Indoyl)Ethyl)-2-Piperidinone |
|---|---|
| Synonyms | 4-[2-(1H-Indol-3-Yl)Ethyl]-2-Piperidinone; 4-[2-(1H-Indol-3-Yl)Ethyl]-2-Piperidone; Pk 10157 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 |
| CAS Registry Number | 80095-30-3 |
| SMILES | C2=C(CCC1CC(NCC1)=O)C3=C([NH]2)C=CC=C3 |
| InChI | 1S/C15H18N2O/c18-15-9-11(7-8-16-15)5-6-12-10-17-14-4-2-1-3-13(12)14/h1-4,10-11,17H,5-9H2,(H,16,18) |
| InChIKey | CAZMDHPORKESKF-UHFFFAOYSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.292°C at 760 mmHg (Cal.) |
| Flash point | 261.811°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-(3-Indoyl)Ethyl)-2-Piperidinone |