|
CAS#: 801170-11-6 Product: 5-[(1E)-1-(4,5-Dimethyl-2H-pyrrol-2-ylidene)ethyl]-2,3-dimethyl-1H-pyrrole No suppilers available for the product. |
| Name | 5-[(1E)-1-(4,5-Dimethyl-2H-pyrrol-2-ylidene)ethyl]-2,3-dimethyl-1H-pyrrole |
|---|---|
| Synonyms | 1H-PYRROL |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 |
| CAS Registry Number | 801170-11-6 |
| SMILES | Cc1cc([nH]c1C)/C(=C/2\C=C(C(=N2)C)C)/C |
| InChI | 1S/C14H18N2/c1-8-6-13(15-11(8)4)10(3)14-7-9(2)12(5)16-14/h6-7,15H,1-5H3/b14-10+ |
| InChIKey | XGMVRVKYMFNFCF-GXDHUFHOSA-N |
| Density | 1.04g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.982°C at 760 mmHg (Cal.) |
| Flash point | 173.326°C (Cal.) |
| Refractive index | 1.565 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-[(1E)-1-(4,5-Dimethyl-2H-pyrrol-2-ylidene)ethyl]-2,3-dimethyl-1H-pyrrole |