|
CAS#: 80126-17-6 Product: 3-Bromo-1,2-Epoxycyclohexane No suppilers available for the product. |
| Name | 3-Bromo-1,2-Epoxycyclohexane |
|---|---|
| Synonyms | 2-Bromo-7-Oxabicyclo(4.1.0)Heptane (1Alpha,2Alpha,6Alpha)-; 7-Oxabicyclo(4.1.0)Heptane, 2-Bromo-, (1Alpha,2Alpha,6Alpha)-; (+-)-Trans-3-Bromo-1,2-Epoxycyclohexane |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9BrO |
| Molecular Weight | 177.04 |
| CAS Registry Number | 80126-17-6 |
| SMILES | [C@H]12[C@@H](CCC[C@H]1O2)Br |
| InChI | 1S/C6H9BrO/c7-4-2-1-3-5-6(4)8-5/h4-6H,1-3H2/t4-,5-,6+/m1/s1 |
| InChIKey | VCXQSVOFNLPVQU-PBXRRBTRSA-N |
| Density | 1.6g/cm3 (Cal.) |
|---|---|
| Boiling point | 202.763°C at 760 mmHg (Cal.) |
| Flash point | 79.709°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-1,2-Epoxycyclohexane |