|
CAS#: 8015-25-6 Product: Amazine No suppilers available for the product. |
| Name | Amazine |
|---|---|
| Synonyms | (4-Chloro-6-Ethylamino-S-Triazin-2-Yl)-Ethyl-Amine; 2H-1,2,4-Triazol-3-Ylamine; Azaplant Kombi; Simatrol |
| Molecular Structure | ![]() |
| Molecular Formula | C9H16ClN9 |
| Molecular Weight | 285.74 |
| CAS Registry Number | 8015-25-6 |
| SMILES | C(NC1=NC(=NC(=N1)Cl)NCC)C.C2=N[NH]C(=N2)N |
| InChI | 1S/C7H12ClN5.C2H4N4/c1-3-9-6-11-5(8)12-7(13-6)10-4-2;3-2-4-1-5-6-2/h3-4H2,1-2H3,(H2,9,10,11,12,13);1H,(H3,3,4,5,6) |
| InChIKey | QRRLMJRIOPVBCX-UHFFFAOYSA-N |
| Boiling point | 365.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 175°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Amazine |