|
CAS#: 80171-68-2 Product: o-(Methoxymethyl)carbanilic acid 2-piperidinoethyl ester oxalate (1:1) No suppilers available for the product. |
| Name | o-(Methoxymethyl)carbanilic acid 2-piperidinoethyl ester oxalate (1:1) |
|---|---|
| Synonyms | 2-Hydroxy-2-Oxo-Acetate; 2-Piperidin-1-Ium-1-Ylethyl N-[2-(Methoxymethyl)Phenyl]Carbamate; 2-Hydroxy-2-Oxoacetate; N-[2-(Methoxymethyl)Phenyl]Carbamic Acid 2-(1-Piperidin-1-Iumyl)Ethyl Ester; N-[2-(Methoxymethyl)Phenyl]Carbamic Acid 2-Piperidin-1-Ium-1-Ylethyl Ester Bioxalate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H26N2O7 |
| Molecular Weight | 382.41 |
| CAS Registry Number | 80171-68-2 |
| SMILES | C2=C(NC(OCC[NH+]1CCCCC1)=O)C(=CC=C2)COC.O=C([O-])C(=O)O |
| InChI | 1S/C16H24N2O3.C2H2O4/c1-20-13-14-7-3-4-8-15(14)17-16(19)21-12-11-18-9-5-2-6-10-18;3-1(4)2(5)6/h3-4,7-8H,2,5-6,9-13H2,1H3,(H,17,19);(H,3,4)(H,5,6) |
| InChIKey | MSKXFFWNJJEANF-UHFFFAOYSA-N |
| Boiling point | 377.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 182.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for o-(Methoxymethyl)carbanilic acid 2-piperidinoethyl ester oxalate (1:1) |