|
CAS#: 80182-33-8 Product: 1-Methyl-3-Nitro-Chrysene No suppilers available for the product. |
| Name | 1-Methyl-3-Nitro-Chrysene |
|---|---|
| Synonyms | 1-Methyl-3-Nitro-Chrysene; Methylnitrochrysene |
| Molecular Structure | ![]() |
| Molecular Formula | C19H13NO2 |
| Molecular Weight | 287.32 |
| CAS Registry Number | 80182-33-8 |
| SMILES | C1=C2C(=C(C=C1[N+]([O-])=O)C)C=CC3=C2C=CC4=C3C=CC=C4 |
| InChI | 1S/C19H13NO2/c1-12-10-14(20(21)22)11-19-15(12)8-9-17-16-5-3-2-4-13(16)6-7-18(17)19/h2-11H,1H3 |
| InChIKey | ZIAOMROBSCTTJG-UHFFFAOYSA-N |
| Density | 1.307g/cm3 (Cal.) |
|---|---|
| Boiling point | 529.927°C at 760 mmHg (Cal.) |
| Flash point | 262.76°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3-Nitro-Chrysene |