|
CAS#: 8033-53-2 Product: Di-sec-octyl phthalate No suppilers available for the product. |
| Name | Di-sec-octyl phthalate |
|---|---|
| Synonyms | Benzene-1,2-Dicarboxylic Acid Bis(2-Ethylhexyl) Ester; Di-Sec-Octyl Phthalate; St5406397 |
| Molecular Structure | ![]() |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 |
| CAS Registry Number | 8033-53-2 |
| SMILES | C1=CC=CC(=C1C(OCC(CCCC)CC)=O)C(OCC(CCCC)CC)=O |
| InChI | 1S/C24H38O4/c1-5-9-13-19(7-3)17-27-23(25)21-15-11-12-16-22(21)24(26)28-18-20(8-4)14-10-6-2/h11-12,15-16,19-20H,5-10,13-14,17-18H2,1-4H3 |
| InChIKey | BJQHLKABXJIVAM-UHFFFAOYSA-N |
| Density | 20 (Expl.) |
|---|---|
| 1.0±0.1g/cm3 (Cal.) | |
| Melting point | -55°C (Expl.) |
| Boiling point | 384.9±10.0°C at 760 mmHg (Cal.) |
| 386.1111°C (Expl.) | |
| Flash point | 207°C (Expl.) |
| 207.222°C (Cal.) | |
| Refractive index | 1.486 (Expl.) |
| Safety Code | S53;S45 Details |
|---|---|
| Risk Code | R60;R61 Details |
| Hazard Symbol | T Details |
| Safety Description | WARNING: Causes CNS injury, birth defects, irritation |
| WARNING: Irreversible damage risk, protect skin/eyes/lungs. | |
| Market Analysis Reports |
| List of Reports Available for Di-sec-octyl phthalate |