|
CAS#: 803636-30-8 Product: 4-[(1E)-1-(4-Methylphenyl)-1-propen-2-yl]aniline No suppilers available for the product. |
| Name | 4-[(1E)-1-(4-Methylphenyl)-1-propen-2-yl]aniline |
|---|---|
| Synonyms | 4-[(1E)-1-(4-Methylphenyl)-1-propen-2-yl]anilin; 4-[(1E)-1-(4-Methylphenyl)-1-propen-2-yl]aniline; 4-[(1E)-1-(4-Méthylphényl)-1-propén-2-yl]aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.31 |
| CAS Registry Number | 803636-30-8 |
| SMILES | Cc1ccc(cc1)/C=C(\C)/c2ccc(cc2)N |
| InChI | 1S/C16H17N/c1-12-3-5-14(6-4-12)11-13(2)15-7-9-16(17)10-8-15/h3-11H,17H2,1-2H3/b13-11+ |
| InChIKey | BDBZGHQVOJTLGX-ACCUITESSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.8±21.0°C at 760 mmHg (Cal.) |
| Flash point | 184.9±17.4°C (Cal.) |
| Refractive index | 1.639 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(1E)-1-(4-Methylphenyl)-1-propen-2-yl]aniline |