|
CAS#: 803723-51-5 Product: (2R,3S)-Bicyclo[2.2.1]hept-5-ene-2,3-diyldimethanol No suppilers available for the product. |
| Name | (2R,3S)-Bicyclo[2.2.1]hept-5-ene-2,3-diyldimethanol |
|---|---|
| Synonyms | (2R,3S)-bicyclo[2.2.1]hept-5-ene-2,3-diyldimethanol; 5-Norbornene-2-endo,3-endo-dimethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 |
| CAS Registry Number | 803723-51-5 |
| SMILES | OC[C@@H]2C1\C=C/C(C1)[C@@H]2CO |
| InChI | 1S/C9H14O2/c10-4-8-6-1-2-7(3-6)9(8)5-11/h1-2,6-11H,3-5H2/t6?,7?,8-,9+ |
| InChIKey | IGHHPVIMEQGKNE-WZENYGAOSA-N |
| Density | 1.137g/cm3 (Cal.) |
|---|---|
| Boiling point | 259.821°C at 760 mmHg (Cal.) |
| Flash point | 122.714°C (Cal.) |
| Refractive index | 1.537 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,3S)-Bicyclo[2.2.1]hept-5-ene-2,3-diyldimethanol |