|
CAS#: 80407-71-2 Product: Lysine Butyrate No suppilers available for the product. |
| Name | Lysine Butyrate |
|---|---|
| Synonyms | Butyric Acid; (2S)-2,6-Diaminohexanoic Acid; L-Lysine, Monobutanoate; Lysine Butyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H22N2O4 |
| Molecular Weight | 234.29 |
| CAS Registry Number | 80407-71-2 |
| SMILES | [C@@H](N)(C(=O)O)CCCCN.C(C(=O)O)CC |
| InChI | 1S/C6H14N2O2.C4H8O2/c7-4-2-1-3-5(8)6(9)10;1-2-3-4(5)6/h5H,1-4,7-8H2,(H,9,10);2-3H2,1H3,(H,5,6)/t5-;/m0./s1 |
| InChIKey | RAQUISHGVNOAMH-JEDNCBNOSA-N |
| Boiling point | 311.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 142.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lysine Butyrate |