|
CAS#: 804449-49-8 Product: 4-[(E)-(3-Ethylphenyl)diazenyl]aniline No suppilers available for the product. |
| Name | 4-[(E)-(3-Ethylphenyl)diazenyl]aniline |
|---|---|
| Synonyms | 4-[(E)-(3-Ethylphenyl)diazenyl]anilin; 4-[(E)-(3-Ethylphenyl)diazenyl]aniline; 4-[(E)-(3-Éthylphényl)diazényl]aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 |
| CAS Registry Number | 804449-49-8 |
| SMILES | CCc1cccc(c1)/N=N/c2ccc(cc2)N |
| InChI | 1S/C14H15N3/c1-2-11-4-3-5-14(10-11)17-16-13-8-6-12(15)7-9-13/h3-10H,2,15H2,1H3/b17-16+ |
| InChIKey | VMXGWSBWVVVWPO-WUKNDPDISA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.8±25.0°C at 760 mmHg (Cal.) |
| Flash point | 194.4±23.2°C (Cal.) |
| Refractive index | 1.592 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(E)-(3-Ethylphenyl)diazenyl]aniline |