|
CAS#: 80480-32-6 Product: N,N,3,5,5-Pentamethylhexanamide No suppilers available for the product. |
| Name | N,N,3,5,5-Pentamethylhexanamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 |
| CAS Registry Number | 80480-32-6 |
| EINECS | 279-483-7 |
| SMILES | C(C(C)(C)C)C(CC(=O)N(C)C)C |
| InChI | 1S/C11H23NO/c1-9(8-11(2,3)4)7-10(13)12(5)6/h9H,7-8H2,1-6H3 |
| InChIKey | DPBOCZZMRUVIDT-UHFFFAOYSA-N |
| Density | 0.862g/cm3 (Cal.) |
|---|---|
| Boiling point | 229.98°C at 760 mmHg (Cal.) |
| Flash point | 81.792°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N,3,5,5-Pentamethylhexanamide |