|
CAS#: 805316-09-0 Product: 2-[(E)-(3-Methylphenyl)diazenyl]aniline No suppilers available for the product. |
| Name | 2-[(E)-(3-Methylphenyl)diazenyl]aniline |
|---|---|
| Synonyms | 2-[(E)-(3-Methylphenyl)diazenyl]anilin; 2-[(E)-(3-Methylphenyl)diazenyl]aniline; 2-[(E)-(3-Méthylphényl)diazényl]aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.26 |
| CAS Registry Number | 805316-09-0 |
| SMILES | Cc1cccc(c1)/N=N/c2ccccc2N |
| InChI | 1S/C13H13N3/c1-10-5-4-6-11(9-10)15-16-13-8-3-2-7-12(13)14/h2-9H,14H2,1H3/b16-15+ |
| InChIKey | PKQOWHKULDJRPV-FOCLMDBBSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.0±35.0°C at 760 mmHg (Cal.) |
| Flash point | 189.7±25.9°C (Cal.) |
| Refractive index | 1.601 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(E)-(3-Methylphenyl)diazenyl]aniline |