Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl 5-[(dimethylamino)methyl]-2-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| Synonyms | ethyl 5-( |
| Molecular Structure | ![CAS#: 805968-66-5, Ethyl 5-[(dimethylamino)methyl]-2-methyl-1H-pyrrole-3-carboxylate](/moreStructures/805968-66-5.gif) |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.27 |
| CAS Registry Number | 805968-66-5 |
| SMILES | CCOC(=O)c1cc([nH]c1C)CN(C)C |
| InChI | 1S/C11H18N2O2/c1-5-15-11(14)10-6-9(7-13(3)4)12-8(10)2/h6,12H,5,7H2,1-4H3 |
| InChIKey | IZCSZEONJGOILQ-UHFFFAOYSA-N |
| Density | 1.078g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.528°C at 760 mmHg (Cal.) |
| Flash point | 154.303°C (Cal.) |
| Refractive index | 1.526 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 5-[(dimethylamino)methyl]-2-methyl-1H-pyrrole-3-carboxylate |