|
CAS#: 80604-83-7 Product: 4-(1-Methyl-2-piperidinyl)-1(2H)-phthalazinone hydrochloride No suppilers available for the product. |
| Name | 4-(1-Methyl-2-piperidinyl)-1(2H)-phthalazinone hydrochloride |
|---|---|
| Synonyms | 4-(1-Methyl-2-Piperidyl)-2H-Phthalazin-1-One Hydrochloride; 4-(1-Methyl-2-Piperidinyl)-2H-Phthalazin-1-One Hydrochloride; 1(2H)-Phthalazinone, 4-(1-Methyl-2-Piperidinyl)-, Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 |
| CAS Registry Number | 80604-83-7 |
| SMILES | [H+].C1=CC=CC2=C1C(=NNC2=O)C3N(CCCC3)C.[Cl-] |
| InChI | 1S/C14H17N3O.ClH/c1-17-9-5-4-8-12(17)13-10-6-2-3-7-11(10)14(18)16-15-13;/h2-3,6-7,12H,4-5,8-9H2,1H3,(H,16,18);1H |
| InChIKey | ACNSBFPODHQPFS-UHFFFAOYSA-N |
| Boiling point | 423.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 209.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1-Methyl-2-piperidinyl)-1(2H)-phthalazinone hydrochloride |