|
CAS#: 80641-49-2 Product: 2-(2-Methyl-1H-Indol-3-Yl)Cyclohexa-2,5-Diene-1,4-Dione No suppilers available for the product. |
| Name | 2-(2-Methyl-1H-Indol-3-Yl)Cyclohexa-2,5-Diene-1,4-Dione |
|---|---|
| Synonyms | 2-(2-Methyl-1H-Indol-3-Yl)-1,4-Benzoquinone; 2-(2-Methyl-1H-Indol-3-Yl)-P-Benzoquinone; Nsc43317 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 |
| CAS Registry Number | 80641-49-2 |
| SMILES | C1=CC=CC2=C1C(=C(C)[NH]2)C3=CC(=O)C=CC3=O |
| InChI | 1S/C15H11NO2/c1-9-15(11-4-2-3-5-13(11)16-9)12-8-10(17)6-7-14(12)18/h2-8,16H,1H3 |
| InChIKey | SYIXSZIGHISTNJ-UHFFFAOYSA-N |
| Density | 1.341g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.546°C at 760 mmHg (Cal.) |
| Flash point | 238.433°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Methyl-1H-Indol-3-Yl)Cyclohexa-2,5-Diene-1,4-Dione |