|
CAS#: 80657-64-3 Product: Ethyl (3aalpha,4alpha,7alpha,7aalpha)-Octahydro-4,7-Methano-3aH-Indene-3a-Carboxylate No suppilers available for the product. |
| Name | Ethyl (3aalpha,4alpha,7alpha,7aalpha)-Octahydro-4,7-Methano-3aH-Indene-3a-Carboxylate |
|---|---|
| Synonyms | Ethyl Hexahydro-4,7-Methanoindane-3A-Carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 |
| CAS Registry Number | 80657-64-3 |
| SMILES | [C@]12(CCC[C@@H]1[C@@H]3CC[C@H]2C3)C(=O)OCC |
| InChI | 1S/C13H20O2/c1-2-15-12(14)13-7-3-4-11(13)9-5-6-10(13)8-9/h9-11H,2-8H2,1H3/t9-,10+,11-,13-/m1/s1 |
| InChIKey | MGQPKOBPXHENPO-LSCVPOLPSA-N |
| Density | 1.106g/cm3 (Cal.) |
|---|---|
| Boiling point | 261.76°C at 760 mmHg (Cal.) |
| Flash point | 109.944°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (3aalpha,4alpha,7alpha,7aalpha)-Octahydro-4,7-Methano-3aH-Indene-3a-Carboxylate |