|
CAS#: 80658-59-9 Product: 2-Bromo-2-nitro-1,3-propanediyl diformate No suppilers available for the product. |
| Name | 2-Bromo-2-nitro-1,3-propanediyl diformate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C5H6BrNO6 |
| Molecular Weight | 256.01 |
| CAS Registry Number | 80658-59-9 |
| EINECS | 279-527-5 |
| SMILES | [O-][N+](=O)C(Br)(COC=O)COC=O |
| InChI | 1S/C5H6BrNO6/c6-5(7(10)11,1-12-3-8)2-13-4-9/h3-4H,1-2H2 |
| InChIKey | WOPMHJCAUNYZEV-UHFFFAOYSA-N |
| Density | 1.772g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.625°C at 760 mmHg (Cal.) |
| Flash point | 138.032°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-2-nitro-1,3-propanediyl diformate |