|
CAS#: 80673-02-5 Product: alpha-(Trichloromethyl)-2-Pyridinemethanol No suppilers available for the product. |
| Name | alpha-(Trichloromethyl)-2-Pyridinemethanol |
|---|---|
| Synonyms | 2,2,2-Trichloro-1-(2-Pyridyl)Ethanol; 2,2,2-Trichloro-1-Pyridin-2-Yl-Ethanol; 2-Pyridinemethanol, Alpha-(Trichloromethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6Cl3NO |
| Molecular Weight | 226.49 |
| CAS Registry Number | 80673-02-5 |
| SMILES | C1=CC=CN=C1C(O)C(Cl)(Cl)Cl |
| InChI | 1S/C7H6Cl3NO/c8-7(9,10)6(12)5-3-1-2-4-11-5/h1-4,6,12H |
| InChIKey | VQQUQMTWROHDAY-UHFFFAOYSA-N |
| Density | 1.531g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.999°C at 760 mmHg (Cal.) |
| Flash point | 136.445°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-(Trichloromethyl)-2-Pyridinemethanol |