|
CAS#: 80687-78-1 Product: 1-Acryloyl-5-oxo-L-proline No suppilers available for the product. |
| Name | 1-Acryloyl-5-oxo-L-proline |
|---|---|
| Synonyms | 5-oxo-1-(1-oxoallyl)-L-proline |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 |
| CAS Registry Number | 80687-78-1 |
| EINECS | 279-530-1 |
| SMILES | O=C1CC[C@@H](C(O)=O)N1C(=O)C=C |
| InChI | 1S/C8H9NO4/c1-2-6(10)9-5(8(12)13)3-4-7(9)11/h2,5H,1,3-4H2,(H,12,13)/t5-/m0/s1 |
| InChIKey | FOBLXEJBFVVAKZ-YFKPBYRVSA-N |
| Density | 1.394g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.001°C at 760 mmHg (Cal.) |
| Flash point | 204.181°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Acryloyl-5-oxo-L-proline |