|
CAS#: 80704-44-5 Product: Dimethyl-[4-[(3-Nitrobenzoyl)Amino]-4-Phenyl-Butyl]Azanium Chloride No suppilers available for the product. |
| Name | Dimethyl-[4-[(3-Nitrobenzoyl)Amino]-4-Phenyl-Butyl]Azanium Chloride |
|---|---|
| Synonyms | Dimethyl-[4-[(3-Nitrobenzoyl)Amino]-4-Phenyl-Butyl]Ammonium Chloride; Dimethyl-[4-[[(3-Nitrophenyl)-Oxomethyl]Amino]-4-Phenylbutyl]Ammonium Chloride; Dimethyl-[4-[(3-Nitrophenyl)Carbonylamino]-4-Phenyl-Butyl]Azanium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 |
| CAS Registry Number | 80704-44-5 |
| SMILES | C2=C(C(=O)NC(C1=CC=CC=C1)CCC[NH+](C)C)C=CC=C2[N+]([O-])=O.[Cl-] |
| InChI | 1S/C19H23N3O3.ClH/c1-21(2)13-7-12-18(15-8-4-3-5-9-15)20-19(23)16-10-6-11-17(14-16)22(24)25;/h3-6,8-11,14,18H,7,12-13H2,1-2H3,(H,20,23);1H |
| InChIKey | YNUNFOBWGVCIFR-UHFFFAOYSA-N |
| Boiling point | 537.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 279.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl-[4-[(3-Nitrobenzoyl)Amino]-4-Phenyl-Butyl]Azanium Chloride |