|
CAS#: 80762-96-5 Product: 1,2-Bis(1,1-Dimethylethoxy)Propane No suppilers available for the product. |
| Name | 1,2-Bis(1,1-Dimethylethoxy)Propane |
|---|---|
| Synonyms | 2-(2-Tert-Butoxy-1-Methyl-Ethoxy)-2-Methyl-Propane; 2-(2-Tert-Butoxy-1-Methylethoxy)-2-Methylpropane; 1,2-Bis(1,1-Dimethylethoxy)Propane |
| Molecular Structure | ![]() |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 |
| CAS Registry Number | 80762-96-5 |
| EINECS | 279-541-1 |
| SMILES | C(OC(C)(C)C)C(OC(C)(C)C)C |
| InChI | 1S/C11H24O2/c1-9(13-11(5,6)7)8-12-10(2,3)4/h9H,8H2,1-7H3 |
| InChIKey | IVZAIGFRIOMAIK-UHFFFAOYSA-N |
| Density | 0.843g/cm3 (Cal.) |
|---|---|
| Boiling point | 177.288°C at 760 mmHg (Cal.) |
| Flash point | 29.92°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Bis(1,1-Dimethylethoxy)Propane |