|
CAS#: 80832-44-6 Product: Pyracrenic Acid No suppilers available for the product. |
| Name | Pyracrenic Acid |
|---|---|
| Synonyms | Lup-20(29)-En-28-Oic Acid, 3-((3-(3,4-Dihydroxyphenyl)-1-Oxo-2-Propenyl)Oxy)-, (3Beta(E))- |
| Molecular Structure | ![]() |
| Molecular Formula | C39H54O6 |
| Molecular Weight | 618.85 |
| CAS Registry Number | 80832-44-6 |
| SMILES | [C@@]46([C@]2([C@@H]([C@]1(CC[C@@H](C([C@@H]1CC2)(C)C)OC(/C=C/C3=CC=C(O)C(=C3)O)=O)C)CC[C@@H]4[C@H]5[C@@H](CC[C@@]5(CC6)C(=O)O)C(=C)C)C)C |
| InChI | 1S/C39H54O6/c1-23(2)25-14-19-39(34(43)44)21-20-37(6)26(33(25)39)10-12-30-36(5)17-16-31(35(3,4)29(36)15-18-38(30,37)7)45-32(42)13-9-24-8-11-27(40)28(41)22-24/h8-9,11,13,22,25-26,29-31,33,40-41H,1,10,12,14-21H2,2-7H3,(H,43,44)/b13-9+/t25-,26+,29-,30+,31-,33+,36-,37+,38+,39-/m0/s1 |
| InChIKey | MNUNUJQYFJZRHQ-VZLLCJDWSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Boiling point | 712.101°C at 760 mmHg (Cal.) |
| Flash point | 213.217°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pyracrenic Acid |