|
CAS#: 80904-85-4 Product: 3-Butyladamantan-1-Amine No suppilers available for the product. |
| Name | 3-Butyladamantan-1-Amine |
|---|---|
| Synonyms | 3-Butyl-1-Adamantanamine; (3-Butyl-1-Adamantyl)Amine; Tricyclo(3.3.1.13,7)Decan-1-Amine, 3-Butyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 |
| CAS Registry Number | 80904-85-4 |
| SMILES | C(C12CC3(N)CC(C1)CC(C2)C3)CCC |
| InChI | 1S/C14H25N/c1-2-3-4-13-6-11-5-12(7-13)9-14(15,8-11)10-13/h11-12H,2-10,15H2,1H3 |
| InChIKey | KUNFZDMYUIQERL-UHFFFAOYSA-N |
| Density | 1.001g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.773°C at 760 mmHg (Cal.) |
| Flash point | 118.272°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Butyladamantan-1-Amine |