|
CAS#: 80912-42-1 Product: Ethyl 1-(4-fluorophenyl)-4-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate No suppilers available for the product. |
| Name | Ethyl 1-(4-fluorophenyl)-4-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H20FN3O3 |
| Molecular Weight | 321.35 |
| CAS Registry Number | 80912-42-1 |
| EINECS | 279-624-2 |
| SMILES | CCOC(=O)N1CCC3(CC1)C(=O)NCN3c2ccc(F)cc2 |
| InChI | 1S/C16H20FN3O3/c1-2-23-15(22)19-9-7-16(8-10-19)14(21)18-11-20(16)13-5-3-12(17)4-6-13/h3-6H,2,7-11H2,1H3,(H,18,21) |
| InChIKey | MPLUISYIZALWBE-UHFFFAOYSA-N |
| Density | 1.327g/cm3 (Cal.) |
|---|---|
| Boiling point | 544.878°C at 760 mmHg (Cal.) |
| Flash point | 283.333°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 1-(4-fluorophenyl)-4-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |