|
CAS#: 80937-24-2 Product: (E)-4-(2-Nitrophenyl)-4-Oxo-2-Butenoic Acid No suppilers available for the product. |
| Name | (E)-4-(2-Nitrophenyl)-4-Oxo-2-Butenoic Acid |
|---|---|
| Synonyms | (E)-4-(2-Nitrophenyl)-4-Oxo-But-2-Enoic Acid; (E)-4-Keto-4-(2-Nitrophenyl)But-2-Enoic Acid; (E)-4-(2-Nitrophenyl)-4-Oxo-2-Butenoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7NO5 |
| Molecular Weight | 221.17 |
| CAS Registry Number | 80937-24-2 |
| SMILES | C1=C(C(=CC=C1)[N+]([O-])=O)C(=O)\C=C\C(=O)O |
| InChI | 1S/C10H7NO5/c12-9(5-6-10(13)14)7-3-1-2-4-8(7)11(15)16/h1-6H,(H,13,14)/b6-5+ |
| InChIKey | PBLUZBCDLSSYAR-AATRIKPKSA-N |
| Density | 1.436g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.415°C at 760 mmHg (Cal.) |
| Flash point | 193.205°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-4-(2-Nitrophenyl)-4-Oxo-2-Butenoic Acid |