Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (386) 462-0788 | |||
|
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | 1-(Trichloromethyl)Butyl Acetate |
|---|---|
| Synonyms | 1-(Trichloromethyl)Butyl Acetate; Acetic Acid 1-(Trichloromethyl)Butyl Ester; 1,1,1-Trichloropentan-2-Yl Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C7H11Cl3O2 |
| Molecular Weight | 233.52 |
| CAS Registry Number | 80982-62-3 |
| SMILES | C(C(C(Cl)(Cl)Cl)OC(C)=O)CC |
| InChI | 1S/C7H11Cl3O2/c1-3-4-6(7(8,9)10)12-5(2)11/h6H,3-4H2,1-2H3 |
| InChIKey | GDKFQJCNNANHST-UHFFFAOYSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.937°C at 760 mmHg (Cal.) |
| Flash point | 113.295°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Trichloromethyl)Butyl Acetate |