|
CAS#: 81-73-2 Product: 6-Aminonaphth[2,3-c]Acridine-5,8,14(13H)-Trione No suppilers available for the product. |
| Name | 6-Aminonaphth[2,3-c]Acridine-5,8,14(13H)-Trione |
|---|---|
| Synonyms | Naphth(2,3-C)Acridine-5,8,14(13H)-Trione, 6-Amino- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H12N2O3 |
| Molecular Weight | 340.34 |
| CAS Registry Number | 81-73-2 |
| EINECS | 201-373-4 |
| SMILES | C1=CC2=C(C=C1)C(=O)C3=C(N2)C4=C(C(=C3)N)C(C5=C(C4=O)C=CC=C5)=O |
| InChI | 1S/C21H12N2O3/c22-14-9-13-18(23-15-8-4-3-7-12(15)19(13)24)17-16(14)20(25)10-5-1-2-6-11(10)21(17)26/h1-9H,22H2,(H,23,24) |
| InChIKey | FLAHKOFOWMLBFH-UHFFFAOYSA-N |
| Density | 1.476g/cm3 (Cal.) |
|---|---|
| Boiling point | 671.89°C at 760 mmHg (Cal.) |
| Flash point | 360.147°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Aminonaphth[2,3-c]Acridine-5,8,14(13H)-Trione |