|
CAS#: 81008-13-1 Product: 4-(4-Nitrophenyl)-4-Oxo-2-Hydroxybutanoic Acid No suppilers available for the product. |
| Name | 4-(4-Nitrophenyl)-4-Oxo-2-Hydroxybutanoic Acid |
|---|---|
| Synonyms | 2-Hydroxy-4-(4-Nitrophenyl)-4-Oxo-Butanoic Acid; 2-Hydroxy-4-Keto-4-(4-Nitrophenyl)Butyric Acid; 4-(4-Nitrophenyl)-4-Oxo-2-Hydroxybutanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO6 |
| Molecular Weight | 239.18 |
| CAS Registry Number | 81008-13-1 |
| SMILES | C1=C(C(=O)CC(O)C(=O)O)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C10H9NO6/c12-8(5-9(13)10(14)15)6-1-3-7(4-2-6)11(16)17/h1-4,9,13H,5H2,(H,14,15) |
| InChIKey | MMFZQNVAJIAIDO-UHFFFAOYSA-N |
| Density | 1.511g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.868°C at 760 mmHg (Cal.) |
| Flash point | 227.881°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Nitrophenyl)-4-Oxo-2-Hydroxybutanoic Acid |